Out of stock
Betaxolol is a pharmaceutical substance that belongs to the class of beta-adrenergic blocking agents. Its systematic name is (RS)-1-[4-(2-Isopropoxyethoxymethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol.
The CAS number for Betaxolol is 63659-18-7. It is mainly used to treat high blood pressure (hypertension) and certain heart conditions, such as angina and arrhythmias. Betaxolol works by blocking the action of certain natural chemicals in the body, such as adrenaline, that can increase heart rate and blood pressure.
It is available in various forms such as tablets and eye drops. When prescribed as eye drops, Betaxolol is commonly used to reduce intraocular pressure in patients with open-angle glaucoma or ocular hypertension. It helps to decrease the production of aqueous humor, reducing the pressure in the eye and preventing damage to the optic nerve.
Betaxolol is typically administered under medical supervision, and the dosage may vary depending on the specific condition being treated. Common side eff
| CAS | 63659-18-7 |
|---|---|
| UNII | O0ZR1R6RZ2 |
| Molecular Formula | C18H29NO3 |
| SMILES | CC(C)NCC(O)COc1ccc(CCOCC2CC2)cc1 |
| INCHIKEY | NWIUTZDMDHAVTP-UHFFFAOYSA-N |
| UUID | d364e9dd-7919-4b3c-a5d1-ff2961db0592 |
| АТС | S01ED52 |
| Изготовитель | Sibbiotech Russia LLC |
