Out of stock
Mometasone is a synthetic corticosteroid drug used primarily as a nasal spray or as a topical cream or ointment for the treatment of allergies and inflammatory skin conditions such as eczema and psoriasis. It is sold under various brand names, including Nasonex, Elocon, and Asmanex.
The CAS number for Mometasone is 105102-22-5.
| CAS | 105102-22-5 |
|---|---|
| UNII | 8HR4QJ6DW8 |
| Molecular Formula | C22H28Cl2O4 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CCl)[C@@]1(C)C[C@H](O)[C@@]3(Cl)[C@@]2([H])CCC4=CC(=O)C=C[C@]34C |
| INCHIKEY | QLIIKPVHVRXHRI-CXSFZGCWSA-N |
| UUID | 20743db5-81d7-4aa4-b553-f0e8c46aa8f1 |
| АТС | D07AC13 |
| Изготовитель | Sibbiotech Russia LLC |
