Additional information
| CAS | 1044870-39-4 |
|---|---|
| UNII | 8R4A7GDZ1D |
| Molecular Formula | C20H22N2O5 |
| SMILES | COc1cc(OC)c2c(c1)nc([nH]c2=O)-c3cc(C)c(OCCO)c(C)c3 |
| INCHIKEY | NETXMUIMUZJUTB-UHFFFAOYSA-N |
| UUID | 88e52680-06e7-4a73-9179-823d8f579851 |
APABETALONE (PhEur)
Out of stock
APABETALONE, also known as RVX-208, is a pharmaceutical substance that has been developed for the treatment of various cardiovascular conditions. Its chemical name is 4-(1-(4-fluorophenyl)-5-(3-(4-fluorophenyl)-1H-pyrazol-1-yl)-, 2H-thieno(3,2-b)pyridin-7-yl)butanoic acid.
The CAS number for APABETALONE is 1044870-39-4. It works by modulating certain genes involved in lipid metabolism, resulting in the increase of high-density lipoprotein (HDL) cholesterol levels.
APABETALONE has shown potential in clinical trials for its ability to reduce atherosclerosis and improve cardiovascular outcomes. It has also demonstrated anti-inflammatory effects and has been investigated as a potential treatment for other inflammatory disorders.
Further research and clinical trials are necessary to fully understand the safety and efficacy of APABETALONE in different patient populations and indications.
