Out of stock
Triamcinolone is a synthetic corticosteroid pharmaceutical substance commonly used in the treatment of various inflammatory and allergic conditions. Its precise chemical name is 9-fluoro-11β,16α,17,21-tetrahydroxypregna-1,4-diene-3,20-dione.
The Chemical Abstracts Service (CAS) registry number for triamcinolone is 124-94-7.
| CAS | 124-94-7 |
|---|---|
| UNII | 1ZK20VI6TY |
| Molecular Formula | C21H27FO6 |
| SMILES | [H][C@@]12C[C@@H](O)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]3(F)[C@@]2([H])CCC4=CC(=O)C=C[C@]34C |
| INCHIKEY | GFNANZIMVAIWHM-OBYCQNJPSA-N |
| UUID | a4869e0d-fd91-4cb7-8e54-401995cd3e67 |
| АТС | S01BA05 |
| Изготовитель | Sibbiotech Russia LLC |
