Out of stock
Product Name: Piperaquine
CAS Number: 4085-31-8
Piperaquine is a pharmaceutical substance that belongs to the class of antimalarial agents. It is used in the treatment and prevention of malaria caused by Plasmodium falciparum and Plasmodium vivax. It exhibits potent antimalarial activity and is commonly administered in combination with other antimalarial drugs, such as artemisinin derivatives, to prevent the development of drug resistance.
Chemically, piperaquine is known as 1,3-bis(4-(7-chloroquinolin-4-yl)piperazin-1-yl)propane. It has a molecular formula of C29H32Cl2N6 with a molecular weight of 549.51 g/mol. Piperaquine acts by primarily inhibiting the growth and replication of the malaria-causing parasites within the red blood cells.
Piperaquine is available in various formulations, including tablets and oral liquid preparations, for convenient administration. The recommended dosage of piperaquine may vary depending on the age, weight, and severity of the malaria infection. However, it is typically ad
| CAS | 4085-31-8 |
|---|---|
| UNII | A0HV2Q956Y |
| Molecular Formula | C29H32Cl2N6 |
| SMILES | Clc1ccc2c(ccnc2c1)N3CCN(CCCN4CCN(CC4)c5ccnc6cc(Cl)ccc56)CC3 |
| INCHIKEY | UCRHFBCYFMIWHC-UHFFFAOYSA-N |
| DRUG CENTRAL | 4193 |
| UUID | a92243ec-f5f0-435f-a58a-1285bfa5b0d8 |
| АТС | P01BF05 |
| Изготовитель | Sibbiotech Russia LLC |
