Out of stock
Prednisolone is a synthetic corticosteroid pharmaceutical substance commonly used as an anti-inflammatory and immunosuppressive drug. It is a white, crystalline powder with the molecular formula C21H28O5.
Prednisolone has a systematic name, 11beta,17,21-trihydroxypregna-1,4-diene-3,20-dione, and is also known by its chemical name, 11beta,17,21-trihydroxypregna-1,4-diene-3,20-dione. Its CAS number is 50-24-8.
This pharmaceutical substance is mainly used to treat various conditions such as allergies, asthma, autoimmune diseases, and certain types of cancers. It works by suppressing the immune system and reducing inflammation in the body. Prednisolone may be administered orally, topically, or through injections, depending on the condition being treated.
It is important to note that prednisolone should be used with caution and under the supervision of a healthcare professional due to its potential side effects, such as increased susceptibility to infections, osteoporosis, weight gain, and mood changes. The do
| CAS | 50-24-8 |
|---|---|
| UNII | 9PHQ9Y1OLM |
| Molecular Formula | C21H28O5 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]3([H])[C@@]2([H])CCC4=CC(=O)C=C[C@]34C |
| INCHIKEY | OIGNJSKKLXVSLS-VWUMJDOOSA-N |
| UUID | 9646220b-4066-4271-9435-e166e3075d55 |
| АТС | S01BA04 |
| Изготовитель | Sibbiotech Russia LLC |
